C12H11F2N3 — CID 63988739
2-(2,5-difluorophenyl)-1-pyrimidin-4-ylethanamine (PubChem CID 63988739) has the molecular formula C12H11F2N3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1-pyrimidin-4-ylethanamine.
| Compound Name | 2-(2,5-difluorophenyl)-1-pyrimidin-4-ylethanamine |
|---|---|
| PubChem CID | 63988739 |
| Molecular Formula | C12H11F2N3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1-pyrimidin-4-ylethanamine |
| SMILES | NC(Cc1cc(F)ccc1F)c1ccncn1 |
| InChI | InChI=1S/C12H11F2N3/c13-9-1-2-10(14)8(5-9)6-11(15)12-3-4-16-7-17-12/h1-5,7,11H,6,15H2 |
| InChIKey | DIOVRIGSBGOMCA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |