C19H26N2O6S — CID 6398920
(2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone;sulfuric acid (PubChem CID 6398920) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone;sulfuric acid.
| Compound Name | (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone;sulfuric acid |
|---|---|
| PubChem CID | 6398920 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone;sulfuric acid |
| SMILES | O=C(/C=C1\NC2(CCCC2)Cc2ccccc21)N1CCOCC1.O=S(=O)(O)O |
| InChI | InChI=1S/C19H24N2O2.H2O4S/c22-18(21-9-11-23-12-10-21)13-17-16-6-2-1-5-15(16)14-19(20-17)7-3-4-8-19;1-5(2,3)4/h1-2,5-6,13,20H,3-4,7-12,14H2;(H2,1,2,3,4)/b17-13-; |
| InChIKey | YVYYGIZGQDKVHB-VSORCOHTSA-N |
| XLogP | 1.69 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|