C14H18Cl2FN — CID 63989941
1-cyclopropyl-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]propan-2-amine (PubChem CID 63989941) has the molecular formula C14H18Cl2FN and a molecular weight of 290.21 g/mol. Its IUPAC name is 1-cyclopropyl-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]propan-2-amine.
| Compound Name | 1-cyclopropyl-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 63989941 |
| Molecular Formula | C14H18Cl2FN |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1-cyclopropyl-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]propan-2-amine |
| SMILES | CC(CC1CC1)NC(C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C14H18Cl2FN/c1-8(7-10-3-4-10)18-9(2)13-11(15)5-6-12(17)14(13)16/h5-6,8-10,18H,3-4,7H2,1-2H3 |
| InChIKey | IBKZEGQGCWSSNO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|