About 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one
5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one (PubChem CID 63990134) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one |
| PubChem CID | 63990134 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one |
| SMILES | CC(CC1CC1)Nc1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C14H19N3O/c1-8(4-9-2-3-9)16-13-7-12-10(5-11(13)15)6-14(18)17-12/h5,7-9,16H,2-4,6,15H2,1H3,(H,17,18) |
| InChIKey | PJTYQYFKHDVHGC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one?
The IUPAC name of 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one (CID 63990134) is 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one?
The canonical SMILES for 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one is CC(CC1CC1)Nc1cc2c(cc1N)CC(=O)N2.
What is the InChIKey of 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one?
The InChIKey is PJTYQYFKHDVHGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O/c1-8(4-9-2-3-9)16-13-7-12-10(5-11(13)15)6-14(18)17-12/h5,7-9,16H,2-4,6,15H2,1H3,(H,17,18).
What are the key properties of 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one?
5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one has a molecular weight of 245.33 g/mol, XLogP of 2.36, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-(1-cyclopropylpropan-2-ylamino)-1,3-dihydroindol-2-one is sourced from PubChem (CID 63990134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).