About (2E)-2-hydroxyimino-1,2-diphenylethanone
(2E)-2-hydroxyimino-1,2-diphenylethanone (PubChem CID 6399014) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-1,2-diphenylethanone.
Molecular Properties
| Compound Name | (2E)-2-hydroxyimino-1,2-diphenylethanone |
| PubChem CID | 6399014 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (2E)-2-hydroxyimino-1,2-diphenylethanone |
| SMILES | O=C(/C(=N/O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H11NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,17H/b15-13+ |
| InChIKey | OLBYFEGTUWWPTR-FYWRMAATSA-N |
| XLogP | 2.75 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-hydroxyimino-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-hydroxyimino-1,2-diphenylethanone?
The IUPAC name of (2E)-2-hydroxyimino-1,2-diphenylethanone (CID 6399014) is (2E)-2-hydroxyimino-1,2-diphenylethanone.
What is the SMILES notation for (2E)-2-hydroxyimino-1,2-diphenylethanone?
The canonical SMILES for (2E)-2-hydroxyimino-1,2-diphenylethanone is O=C(/C(=N/O)c1ccccc1)c1ccccc1.
What is the InChIKey of (2E)-2-hydroxyimino-1,2-diphenylethanone?
The InChIKey is OLBYFEGTUWWPTR-FYWRMAATSA-N. The full InChI is InChI=1S/C14H11NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,17H/b15-13+.
What are the key properties of (2E)-2-hydroxyimino-1,2-diphenylethanone?
(2E)-2-hydroxyimino-1,2-diphenylethanone has a molecular weight of 225.25 g/mol, XLogP of 2.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-hydroxyimino-1,2-diphenylethanone is sourced from PubChem (CID 6399014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).