C18H23NS2 — CID 63991268
4-cyclopentylsulfanyl-N-[1-(3-methylthiophen-2-yl)ethyl]aniline (PubChem CID 63991268) has the molecular formula C18H23NS2 and a molecular weight of 317.52 g/mol. Its IUPAC name is 4-cyclopentylsulfanyl-N-[1-(3-methylthiophen-2-yl)ethyl]aniline.
| Compound Name | 4-cyclopentylsulfanyl-N-[1-(3-methylthiophen-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 63991268 |
| Molecular Formula | C18H23NS2 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-cyclopentylsulfanyl-N-[1-(3-methylthiophen-2-yl)ethyl]aniline |
| SMILES | Cc1ccsc1C(C)Nc1ccc(SC2CCCC2)cc1 |
| InChI | InChI=1S/C18H23NS2/c1-13-11-12-20-18(13)14(2)19-15-7-9-17(10-8-15)21-16-5-3-4-6-16/h7-12,14,16,19H,3-6H2,1-2H3 |
| InChIKey | WIFDLGQSYDNDJU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |