C40H66N2O2 — CID 639918
4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-1-N,1-N,3-N,3-N-tetrahexylbenzene-1,3-diamine (PubChem CID 639918) has the molecular formula C40H66N2O2 and a molecular weight of 606.98 g/mol. Its IUPAC name is 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-1-N,1-N,3-N,3-N-tetrahexylbenzene-1,3-diamine.
| Compound Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-1-N,1-N,3-N,3-N-tetrahexylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 639918 |
| Molecular Formula | C40H66N2O2 |
| Molecular Weight | 606.98 g/mol |
| Exact Mass | 606.51 |
| IUPAC Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-1-N,1-N,3-N,3-N-tetrahexylbenzene-1,3-diamine |
| SMILES | CCCCCCN(CCCCCC)c1ccc(/C=C/c2cc(OC)cc(OC)c2)c(N(CCCCCC)CCCCCC)c1 |
| InChI | InChI=1S/C40H66N2O2/c1-7-11-15-19-27-41(28-20-16-12-8-2)37-26-25-36(24-23-35-31-38(43-5)34-39(32-35)44-6)40(33-37)42(29-21-17-13-9-3)30-22-18-14-10-4/h23-26,31-34H,7-22,27-30H2,1-6H3/b24-23+ |
| InChIKey | KQQOMAQQPRQDBO-WCWDXBQESA-N |
| XLogP | 11.81 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.98 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|