About 1,2-Cyclohexanedione dithiosemicarbazone
1,2-Cyclohexanedione dithiosemicarbazone (PubChem CID 6399292) has the molecular formula C8H14N6S2
and a molecular weight of 258.40 g/mol. Its IUPAC name is [(Z)-[(2E)-2-(carbamothioylhydrazinylidene)cyclohexylidene]amino]thiourea.
Molecular Properties
| Compound Name | 1,2-Cyclohexanedione dithiosemicarbazone |
| PubChem CID | 6399292 |
| Molecular Formula | C8H14N6S2 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | [(Z)-[(2E)-2-(carbamothioylhydrazinylidene)cyclohexylidene]amino]thiourea |
| SMILES | C1CC/C(=N/NC(=S)N)/C(=N/NC(=S)N)/C1 |
| InChI | InChI=1S/C8H14N6S2/c9-7(15)13-11-5-3-1-2-4-6(5)12-14-8(10)16/h1-4H2,(H3,9,13,15)(H3,10,14,16)/b11-5-,12-6+ |
| InChIKey | KUFDKDMUQRYPCC-JTAXDKCCSA-N |
| XLogP | -0.40 |
| TPSA | 165.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 314 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,2-Cyclohexanedione dithiosemicarbazone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-Cyclohexanedione dithiosemicarbazone?
The IUPAC name of 1,2-Cyclohexanedione dithiosemicarbazone (CID 6399292) is [(Z)-[(2E)-2-(carbamothioylhydrazinylidene)cyclohexylidene]amino]thiourea.
What is the SMILES notation for 1,2-Cyclohexanedione dithiosemicarbazone?
The canonical SMILES for 1,2-Cyclohexanedione dithiosemicarbazone is C1CC/C(=N/NC(=S)N)/C(=N/NC(=S)N)/C1.
What is the InChIKey of 1,2-Cyclohexanedione dithiosemicarbazone?
The InChIKey is KUFDKDMUQRYPCC-JTAXDKCCSA-N. The full InChI is InChI=1S/C8H14N6S2/c9-7(15)13-11-5-3-1-2-4-6(5)12-14-8(10)16/h1-4H2,(H3,9,13,15)(H3,10,14,16)/b11-5-,12-6+.
What are the key properties of 1,2-Cyclohexanedione dithiosemicarbazone?
1,2-Cyclohexanedione dithiosemicarbazone has a molecular weight of 258.40 g/mol, XLogP of -0.40, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-Cyclohexanedione dithiosemicarbazone is sourced from PubChem (CID 6399292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).