C17H21FN2S — CID 63993464
3-fluoro-N-[1-(3-methylthiophen-2-yl)ethyl]-4-pyrrolidin-1-ylaniline (PubChem CID 63993464) has the molecular formula C17H21FN2S and a molecular weight of 304.43 g/mol. Its IUPAC name is 3-fluoro-N-[1-(3-methylthiophen-2-yl)ethyl]-4-pyrrolidin-1-ylaniline.
| Compound Name | 3-fluoro-N-[1-(3-methylthiophen-2-yl)ethyl]-4-pyrrolidin-1-ylaniline |
|---|---|
| PubChem CID | 63993464 |
| Molecular Formula | C17H21FN2S |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-fluoro-N-[1-(3-methylthiophen-2-yl)ethyl]-4-pyrrolidin-1-ylaniline |
| SMILES | Cc1ccsc1C(C)Nc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C17H21FN2S/c1-12-7-10-21-17(12)13(2)19-14-5-6-16(15(18)11-14)20-8-3-4-9-20/h5-7,10-11,13,19H,3-4,8-9H2,1-2H3 |
| InChIKey | BVBXJCJARHSTRI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|