About 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile
4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile (PubChem CID 63994071) has the molecular formula C17H24N2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile |
| PubChem CID | 63994071 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile |
| SMILES | CC1CCC(NC(C)c2ccc(C#N)cc2)C(C)C1 |
| InChI | InChI=1S/C17H24N2/c1-12-4-9-17(13(2)10-12)19-14(3)16-7-5-15(11-18)6-8-16/h5-8,12-14,17,19H,4,9-10H2,1-3H3 |
| InChIKey | MDFUZKDPSUNCOT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile?
The IUPAC name of 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile (CID 63994071) is 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile.
What is the SMILES notation for 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile?
The canonical SMILES for 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile is CC1CCC(NC(C)c2ccc(C#N)cc2)C(C)C1.
What is the InChIKey of 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile?
The InChIKey is MDFUZKDPSUNCOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2/c1-12-4-9-17(13(2)10-12)19-14(3)16-7-5-15(11-18)6-8-16/h5-8,12-14,17,19H,4,9-10H2,1-3H3.
What are the key properties of 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile?
4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile has a molecular weight of 256.39 g/mol, XLogP of 4.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(2,4-dimethylcyclohexyl)amino]ethyl]benzonitrile is sourced from PubChem (CID 63994071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).