C14H18F2N2O — CID 63994420
4-amino-N-(1-cyclopropylbutan-2-yl)-3,5-difluorobenzamide (PubChem CID 63994420) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-amino-N-(1-cyclopropylbutan-2-yl)-3,5-difluorobenzamide.
| Compound Name | 4-amino-N-(1-cyclopropylbutan-2-yl)-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 63994420 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-amino-N-(1-cyclopropylbutan-2-yl)-3,5-difluorobenzamide |
| SMILES | CCC(CC1CC1)NC(=O)c1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C14H18F2N2O/c1-2-10(5-8-3-4-8)18-14(19)9-6-11(15)13(17)12(16)7-9/h6-8,10H,2-5,17H2,1H3,(H,18,19) |
| InChIKey | GTWVACPPAOPMPL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|