4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid

C15H27NO3 — CID 63994833

IUPAC4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid
SMILESCCC(CC1CC1)NC(=O)CC(CC)(CC)C(=O)O
InChIInChI=1S/C15H27NO3/c1-4-12(9-11-7-8-11)16-13(17)10-15(5-2,6-3)14(18)19/h11-12H,4-10H2,1-3H3,(H,16,17)(H,18,19)
InChIKeyLNQXHVMOUBRQPK-UHFFFAOYSA-N
MW269.38 g/mol
LogP2.96
Rot. Bonds9

About 4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid

4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid (PubChem CID 63994833) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is 4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid
PubChem CID63994833
Molecular FormulaC15H27NO3
Molecular Weight269.38 g/mol
Exact Mass269.20
IUPAC Name4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid
SMILESCCC(CC1CC1)NC(=O)CC(CC)(CC)C(=O)O
InChIInChI=1S/C15H27NO3/c1-4-12(9-11-7-8-11)16-13(17)10-15(5-2,6-3)14(18)19/h11-12H,4-10H2,1-3H3,(H,16,17)(H,18,19)
InChIKeyLNQXHVMOUBRQPK-UHFFFAOYSA-N
XLogP2.96
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.38
LogP ≤ 52.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid?
The IUPAC name of 4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid (CID 63994833) is 4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid is CCC(CC1CC1)NC(=O)CC(CC)(CC)C(=O)O.
What is the InChIKey of 4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid?
The InChIKey is LNQXHVMOUBRQPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3/c1-4-12(9-11-7-8-11)16-13(17)10-15(5-2,6-3)14(18)19/h11-12H,4-10H2,1-3H3,(H,16,17)(H,18,19).
What are the key properties of 4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid?
4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid has a molecular weight of 269.38 g/mol, XLogP of 2.96, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-cyclopropylbutan-2-ylamino)-2,2-diethyl-4-oxobutanoic acid is sourced from PubChem (CID 63994833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).