About 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol
4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol (PubChem CID 63995495) has the molecular formula C12H23NO3S
and a molecular weight of 261.39 g/mol. Its IUPAC name is 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol |
| PubChem CID | 63995495 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol |
| SMILES | CC1CCC(NC2CS(=O)(=O)CC2O)C(C)C1 |
| InChI | InChI=1S/C12H23NO3S/c1-8-3-4-10(9(2)5-8)13-11-6-17(15,16)7-12(11)14/h8-14H,3-7H2,1-2H3 |
| InChIKey | YQZPDTLAXXIBNM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol (CID 63995495) is 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol is CC1CCC(NC2CS(=O)(=O)CC2O)C(C)C1.
What is the InChIKey of 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol?
The InChIKey is YQZPDTLAXXIBNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3S/c1-8-3-4-10(9(2)5-8)13-11-6-17(15,16)7-12(11)14/h8-14H,3-7H2,1-2H3.
What are the key properties of 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol?
4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol has a molecular weight of 261.39 g/mol, XLogP of 0.56, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-dimethylcyclohexyl)amino]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 63995495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).