C13H21N3 — CID 63995658
5-N-(2,4-dimethylcyclohexyl)pyridine-2,5-diamine (PubChem CID 63995658) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 5-N-(2,4-dimethylcyclohexyl)pyridine-2,5-diamine.
| Compound Name | 5-N-(2,4-dimethylcyclohexyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 63995658 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 5-N-(2,4-dimethylcyclohexyl)pyridine-2,5-diamine |
| SMILES | CC1CCC(Nc2ccc(N)nc2)C(C)C1 |
| InChI | InChI=1S/C13H21N3/c1-9-3-5-12(10(2)7-9)16-11-4-6-13(14)15-8-11/h4,6,8-10,12,16H,3,5,7H2,1-2H3,(H2,14,15) |
| InChIKey | OIJOADRZKXFWRN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |