C13H7F5O3S — CID 639958
(2,3,4,5,6-pentafluorophenyl) 4-methylbenzenesulfonate (PubChem CID 639958) has the molecular formula C13H7F5O3S and a molecular weight of 338.25 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-methylbenzenesulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 639958 |
| Molecular Formula | C13H7F5O3S |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H7F5O3S/c1-6-2-4-7(5-3-6)22(19,20)21-13-11(17)9(15)8(14)10(16)12(13)18/h2-5H,1H3 |
| InChIKey | IMTDUXYMXVJZPD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|