C16H23N3S — CID 63995855
5-N-(2,4-dimethylcyclohexyl)-2-methyl-1,3-benzothiazole-5,6-diamine (PubChem CID 63995855) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 5-N-(2,4-dimethylcyclohexyl)-2-methyl-1,3-benzothiazole-5,6-diamine.
| Compound Name | 5-N-(2,4-dimethylcyclohexyl)-2-methyl-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 63995855 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 5-N-(2,4-dimethylcyclohexyl)-2-methyl-1,3-benzothiazole-5,6-diamine |
| SMILES | Cc1nc2cc(NC3CCC(C)CC3C)c(N)cc2s1 |
| InChI | InChI=1S/C16H23N3S/c1-9-4-5-13(10(2)6-9)19-14-8-15-16(7-12(14)17)20-11(3)18-15/h7-10,13,19H,4-6,17H2,1-3H3 |
| InChIKey | BBWSZNPWIPEGMO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|