C12H16N2O3S — CID 63998092
2-amino-4-methoxy-N-(2-methylbut-3-yn-2-yl)benzenesulfonamide (PubChem CID 63998092) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-amino-4-methoxy-N-(2-methylbut-3-yn-2-yl)benzenesulfonamide.
| Compound Name | 2-amino-4-methoxy-N-(2-methylbut-3-yn-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 63998092 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-amino-4-methoxy-N-(2-methylbut-3-yn-2-yl)benzenesulfonamide |
| SMILES | C#CC(C)(C)NS(=O)(=O)c1ccc(OC)cc1N |
| InChI | InChI=1S/C12H16N2O3S/c1-5-12(2,3)14-18(15,16)11-7-6-9(17-4)8-10(11)13/h1,6-8,14H,13H2,2-4H3 |
| InChIKey | SNCKYKZOLDWWGX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|