About 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine
5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine (PubChem CID 63998765) has the molecular formula C15H20BrN3
and a molecular weight of 322.25 g/mol. Its IUPAC name is 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine.
Molecular Properties
| Compound Name | 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine |
| PubChem CID | 63998765 |
| Molecular Formula | C15H20BrN3 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine |
| SMILES | CC1CCC(n2c(N)nc3cc(Br)ccc32)C(C)C1 |
| InChI | InChI=1S/C15H20BrN3/c1-9-3-5-13(10(2)7-9)19-14-6-4-11(16)8-12(14)18-15(19)17/h4,6,8-10,13H,3,5,7H2,1-2H3,(H2,17,18) |
| InChIKey | WBWCESRBWACDIL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine?
The IUPAC name of 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine (CID 63998765) is 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine.
What is the SMILES notation for 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine?
The canonical SMILES for 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine is CC1CCC(n2c(N)nc3cc(Br)ccc32)C(C)C1.
What is the InChIKey of 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine?
The InChIKey is WBWCESRBWACDIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrN3/c1-9-3-5-13(10(2)7-9)19-14-6-4-11(16)8-12(14)18-15(19)17/h4,6,8-10,13H,3,5,7H2,1-2H3,(H2,17,18).
What are the key properties of 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine?
5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine has a molecular weight of 322.25 g/mol, XLogP of 4.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-(2,4-dimethylcyclohexyl)benzimidazol-2-amine is sourced from PubChem (CID 63998765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).