C11H12N2O3 — CID 639991
4,4-dimethyl-2-(3-nitrophenyl)-5H-1,3-oxazole (PubChem CID 639991) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 4,4-dimethyl-2-(3-nitrophenyl)-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-(3-nitrophenyl)-5H-1,3-oxazole |
|---|---|
| PubChem CID | 639991 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 4,4-dimethyl-2-(3-nitrophenyl)-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2cccc([N+](=O)[O-])c2)=N1 |
| InChI | InChI=1S/C11H12N2O3/c1-11(2)7-16-10(12-11)8-4-3-5-9(6-8)13(14)15/h3-6H,7H2,1-2H3 |
| InChIKey | QIAYGYJTXPWMBQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|