About 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine
2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine (PubChem CID 640035) has the molecular formula C35H41NO4
and a molecular weight of 539.72 g/mol. Its IUPAC name is 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine.
Molecular Properties
| Compound Name | 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine |
| PubChem CID | 640035 |
| Molecular Formula | C35H41NO4 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine |
| SMILES | CCCOc1ccc(OCCC)c(-c2cc(-c3ccccc3)nc(-c3cc(OCCC)ccc3OCCC)c2)c1 |
| InChI | InChI=1S/C35H41NO4/c1-5-18-37-28-14-16-34(39-20-7-3)30(24-28)27-22-32(26-12-10-9-11-13-26)36-33(23-27)31-25-29(38-19-6-2)15-17-35(31)40-21-8-4/h9-17,22-25H,5-8,18-21H2,1-4H3 |
| InChIKey | RNFHBILYVMEYTK-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine?
The IUPAC name of 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine (CID 640035) is 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine.
What is the SMILES notation for 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine?
The canonical SMILES for 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine is CCCOc1ccc(OCCC)c(-c2cc(-c3ccccc3)nc(-c3cc(OCCC)ccc3OCCC)c2)c1.
What is the InChIKey of 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine?
The InChIKey is RNFHBILYVMEYTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H41NO4/c1-5-18-37-28-14-16-34(39-20-7-3)30(24-28)27-22-32(26-12-10-9-11-13-26)36-33(23-27)31-25-29(38-19-6-2)15-17-35(31)40-21-8-4/h9-17,22-25H,5-8,18-21H2,1-4H3.
What are the key properties of 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine?
2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine has a molecular weight of 539.72 g/mol, XLogP of 9.24, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(2,5-dipropoxyphenyl)-6-phenylpyridine is sourced from PubChem (CID 640035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).