About 6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride
6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride (PubChem CID 6400718) has the molecular formula C4H8ClN5
and a molecular weight of 161.60 g/mol. Its IUPAC name is 6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride.
Analyze 6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride?
The IUPAC name of 6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride (CID 6400718) is 6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride.
What is the SMILES notation for 6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride?
The canonical SMILES for 6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride is CC1=NN=C(N)NN=C1.Cl.
What is the InChIKey of 6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride?
The InChIKey is CVGDJVJXKAMFNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5.ClH/c1-3-2-6-8-4(5)9-7-3;/h2H,1H3,(H3,5,8,9);1H.
What are the key properties of 6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride?
6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride has a molecular weight of 161.60 g/mol, XLogP of -0.31, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2H-1,2,4,5-tetrazepin-3-amine;hydrochloride is sourced from PubChem (CID 6400718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).