About 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide
4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide (PubChem CID 6400920) has the molecular formula C15H19IN4O
and a molecular weight of 398.25 g/mol. Its IUPAC name is 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide.
Molecular Properties
| Compound Name | 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide |
| PubChem CID | 6400920 |
| Molecular Formula | C15H19IN4O |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide |
| SMILES | CC[n+]1cc(-c2ccccc2)nc(N2CCOCC2)n1.[I-] |
| InChI | InChI=1S/C15H19N4O.HI/c1-2-19-12-14(13-6-4-3-5-7-13)16-15(17-19)18-8-10-20-11-9-18;/h3-7,12H,2,8-11H2,1H3;1H/q+1;/p-1 |
| InChIKey | XAGHRBDYDAMXHL-UHFFFAOYSA-M |
| XLogP | -1.71 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide?
The IUPAC name of 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide (CID 6400920) is 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide.
What is the SMILES notation for 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide?
The canonical SMILES for 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide is CC[n+]1cc(-c2ccccc2)nc(N2CCOCC2)n1.[I-].
What is the InChIKey of 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide?
The InChIKey is XAGHRBDYDAMXHL-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H19N4O.HI/c1-2-19-12-14(13-6-4-3-5-7-13)16-15(17-19)18-8-10-20-11-9-18;/h3-7,12H,2,8-11H2,1H3;1H/q+1;/p-1.
What are the key properties of 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide?
4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide has a molecular weight of 398.25 g/mol, XLogP of -1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-ethyl-5-phenyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide is sourced from PubChem (CID 6400920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).