C10H10N6 — CID 6401261
(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine (PubChem CID 6401261) has the molecular formula C10H10N6 and a molecular weight of 214.23 g/mol. Its IUPAC name is (8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine.
| Compound Name | (8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine |
|---|---|
| PubChem CID | 6401261 |
| Molecular Formula | C10H10N6 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazine |
| SMILES | Cc1ccc2[nH]c3nc(NN)nnc3c2c1 |
| InChI | InChI=1S/C10H10N6/c1-5-2-3-7-6(4-5)8-9(12-7)13-10(14-11)16-15-8/h2-4H,11H2,1H3,(H2,12,13,14,16) |
| InChIKey | QNIGVTNBJSLTIS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|