C9H8N6 — CID 6401400
9H-[1,2,4]triazino[6,5-b]indol-3-ylhydrazine (PubChem CID 6401400) has the molecular formula C9H8N6 and a molecular weight of 200.21 g/mol. Its IUPAC name is 9H-[1,2,4]triazino[6,5-b]indol-3-ylhydrazine.
| Compound Name | 9H-[1,2,4]triazino[6,5-b]indol-3-ylhydrazine |
|---|---|
| PubChem CID | 6401400 |
| Molecular Formula | C9H8N6 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 9H-[1,2,4]triazino[6,5-b]indol-3-ylhydrazine |
| SMILES | NNc1nnc2[nH]c3ccccc3c2n1 |
| InChI | InChI=1S/C9H8N6/c10-13-9-12-7-5-3-1-2-4-6(5)11-8(7)14-15-9/h1-4H,10H2,(H,11,14)(H,12,13,15) |
| InChIKey | WYLAEVQULAAUHI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|