About 3,4-diphenylthieno[2,3-c]pyridazin-5-ol
3,4-diphenylthieno[2,3-c]pyridazin-5-ol (PubChem CID 6401461) has the molecular formula C18H12N2OS
and a molecular weight of 304.37 g/mol. Its IUPAC name is 3,4-diphenylthieno[2,3-c]pyridazin-5-ol.
Molecular Properties
| Compound Name | 3,4-diphenylthieno[2,3-c]pyridazin-5-ol |
| PubChem CID | 6401461 |
| Molecular Formula | C18H12N2OS |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3,4-diphenylthieno[2,3-c]pyridazin-5-ol |
| SMILES | Oc1csc2nnc(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C18H12N2OS/c21-14-11-22-18-16(14)15(12-7-3-1-4-8-12)17(19-20-18)13-9-5-2-6-10-13/h1-11,21H |
| InChIKey | NXVOPFJBDOQYFF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diphenylthieno[2,3-c]pyridazin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diphenylthieno[2,3-c]pyridazin-5-ol?
The IUPAC name of 3,4-diphenylthieno[2,3-c]pyridazin-5-ol (CID 6401461) is 3,4-diphenylthieno[2,3-c]pyridazin-5-ol.
What is the SMILES notation for 3,4-diphenylthieno[2,3-c]pyridazin-5-ol?
The canonical SMILES for 3,4-diphenylthieno[2,3-c]pyridazin-5-ol is Oc1csc2nnc(-c3ccccc3)c(-c3ccccc3)c12.
What is the InChIKey of 3,4-diphenylthieno[2,3-c]pyridazin-5-ol?
The InChIKey is NXVOPFJBDOQYFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2OS/c21-14-11-22-18-16(14)15(12-7-3-1-4-8-12)17(19-20-18)13-9-5-2-6-10-13/h1-11,21H.
What are the key properties of 3,4-diphenylthieno[2,3-c]pyridazin-5-ol?
3,4-diphenylthieno[2,3-c]pyridazin-5-ol has a molecular weight of 304.37 g/mol, XLogP of 4.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diphenylthieno[2,3-c]pyridazin-5-ol is sourced from PubChem (CID 6401461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).