C31H37NO10 — CID 640147
[(2S,4aR,6R,7R,8R,8aS)-6-(6-methoxy-6-oxohexoxy)-2-phenyl-7-(prop-2-enoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate (PubChem CID 640147) has the molecular formula C31H37NO10 and a molecular weight of 583.63 g/mol. Its IUPAC name is [(2S,4aR,6R,7R,8R,8aS)-6-(6-methoxy-6-oxohexoxy)-2-phenyl-7-(prop-2-enoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate.
| Compound Name | [(2S,4aR,6R,7R,8R,8aS)-6-(6-methoxy-6-oxohexoxy)-2-phenyl-7-(prop-2-enoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
|---|---|
| PubChem CID | 640147 |
| Molecular Formula | C31H37NO10 |
| Molecular Weight | 583.63 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | [(2S,4aR,6R,7R,8R,8aS)-6-(6-methoxy-6-oxohexoxy)-2-phenyl-7-(prop-2-enoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
| SMILES | C=CCOC(=O)N[C@H]1[C@H](OCCCCCC(=O)OC)O[C@@H]2CO[C@H](c3ccccc3)O[C@H]2[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H37NO10/c1-3-18-38-31(35)32-25-27(41-28(34)21-13-7-4-8-14-21)26-23(20-39-29(42-26)22-15-9-5-10-16-22)40-30(25)37-19-12-6-11-17-24(33)36-2/h3-5,7-10,13-16,23,25-27,29-30H,1,6,11-12,17-20H2,2H3,(H,32,35)/t23-,25-,26-,27-,29+,30-/m1/s1 |
| InChIKey | IVDPSMIYQGDQBI-DPPNACROSA-N |
| XLogP | 4.08 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|