About 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine
1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine (PubChem CID 6401668) has the molecular formula C17H15ClN2O2
and a molecular weight of 314.77 g/mol. Its IUPAC name is 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine.
Molecular Properties
| Compound Name | 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine |
| PubChem CID | 6401668 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine |
| SMILES | COc1ccc(Cc2nnc(Cl)c3ccccc23)cc1OC |
| InChI | InChI=1S/C17H15ClN2O2/c1-21-15-8-7-11(10-16(15)22-2)9-14-12-5-3-4-6-13(12)17(18)20-19-14/h3-8,10H,9H2,1-2H3 |
| InChIKey | HNICWSFEJZGZDD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine?
The IUPAC name of 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine (CID 6401668) is 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine.
What is the SMILES notation for 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine?
The canonical SMILES for 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine is COc1ccc(Cc2nnc(Cl)c3ccccc23)cc1OC.
What is the InChIKey of 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine?
The InChIKey is HNICWSFEJZGZDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN2O2/c1-21-15-8-7-11(10-16(15)22-2)9-14-12-5-3-4-6-13(12)17(18)20-19-14/h3-8,10H,9H2,1-2H3.
What are the key properties of 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine?
1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine has a molecular weight of 314.77 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[(3,4-dimethoxyphenyl)methyl]phthalazine is sourced from PubChem (CID 6401668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).