C20H20N4O — CID 6401682
N-(5,6-diphenyl-1,2,4-triazin-3-yl)-2,2-dimethylpropanamide (PubChem CID 6401682) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is N-(5,6-diphenyl-1,2,4-triazin-3-yl)-2,2-dimethylpropanamide.
| Compound Name | N-(5,6-diphenyl-1,2,4-triazin-3-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 6401682 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-(5,6-diphenyl-1,2,4-triazin-3-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1nnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H20N4O/c1-20(2,3)18(25)22-19-21-16(14-10-6-4-7-11-14)17(23-24-19)15-12-8-5-9-13-15/h4-13H,1-3H3,(H,21,22,24,25) |
| InChIKey | RVPRDXUQZPVHBY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |