C24H18N3O2+ — CID 6401793
4-(3,4-diaza-11-azoniahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,5,7,9,11,13,15,17,19(23),20-undecaen-11-yl)butanoic acid (PubChem CID 6401793) has the molecular formula C24H18N3O2+ and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-(3,4-diaza-11-azoniahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,5,7,9,11,13,15,17,19(23),20-undecaen-11-yl)butanoic acid.
| Compound Name | 4-(3,4-diaza-11-azoniahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,5,7,9,11,13,15,17,19(23),20-undecaen-11-yl)butanoic acid |
|---|---|
| PubChem CID | 6401793 |
| Molecular Formula | C24H18N3O2+ |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 4-(3,4-diaza-11-azoniahexacyclo[13.7.1.02,14.04,12.05,10.019,23]tricosa-1(22),2,5,7,9,11,13,15,17,19(23),20-undecaen-11-yl)butanoic acid |
| SMILES | O=C(O)CCC[n+]1c2ccccc2n2nc3c(cc21)c1cccc2cccc3c21 |
| InChI | InChI=1S/C24H17N3O2/c28-22(29)12-5-13-26-19-10-1-2-11-20(19)27-21(26)14-18-16-8-3-6-15-7-4-9-17(23(15)16)24(18)25-27/h1-4,6-11,14H,5,12-13H2/p+1 |
| InChIKey | SQEPKWOCORROJG-UHFFFAOYSA-O |
| XLogP | 4.54 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|