C23H22N4O5S — CID 6401956
[4-[(6R)-7-acetyl-3-ethylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-2-methoxyphenyl] acetate (PubChem CID 6401956) has the molecular formula C23H22N4O5S and a molecular weight of 466.52 g/mol. Its IUPAC name is [4-[(6R)-7-acetyl-3-ethylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(6R)-7-acetyl-3-ethylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 6401956 |
| Molecular Formula | C23H22N4O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [4-[(6R)-7-acetyl-3-ethylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-2-methoxyphenyl] acetate |
| SMILES | CCSc1nnc2c(n1)O[C@H](c1ccc(OC(C)=O)c(OC)c1)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C23H22N4O5S/c1-5-33-23-24-21-20(25-26-23)16-8-6-7-9-17(16)27(13(2)28)22(32-21)15-10-11-18(31-14(3)29)19(12-15)30-4/h6-12,22H,5H2,1-4H3/t22-/m1/s1 |
| InChIKey | JRIROVRPNSIQFE-JOCHJYFZSA-N |
| XLogP | 4.03 |
| TPSA | 103.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|