C24H19N5O5S — CID 6402089
1-[(6R)-3-methylsulfanyl-6-[5-(3-nitrophenyl)furan-2-yl]-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]propan-1-one (PubChem CID 6402089) has the molecular formula C24H19N5O5S and a molecular weight of 489.51 g/mol. Its IUPAC name is 1-[(6R)-3-methylsulfanyl-6-[5-(3-nitrophenyl)furan-2-yl]-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]propan-1-one.
| Compound Name | 1-[(6R)-3-methylsulfanyl-6-[5-(3-nitrophenyl)furan-2-yl]-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]propan-1-one |
|---|---|
| PubChem CID | 6402089 |
| Molecular Formula | C24H19N5O5S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 1-[(6R)-3-methylsulfanyl-6-[5-(3-nitrophenyl)furan-2-yl]-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]propan-1-one |
| SMILES | CCC(=O)N1c2ccccc2-c2nnc(SC)nc2O[C@@H]1c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C24H19N5O5S/c1-3-20(30)28-17-10-5-4-9-16(17)21-22(25-24(35-2)27-26-21)34-23(28)19-12-11-18(33-19)14-7-6-8-15(13-14)29(31)32/h4-13,23H,3H2,1-2H3/t23-/m1/s1 |
| InChIKey | QFOZOBFNFWFFNB-HSZRJFAPSA-N |
| XLogP | 5.26 |
| TPSA | 124.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|