C17H15BrN4O2 — CID 6402428
4-[6-(4-bromophenyl)-3-(furan-2-yl)-1,2,4-triazin-5-yl]morpholine (PubChem CID 6402428) has the molecular formula C17H15BrN4O2 and a molecular weight of 387.24 g/mol. Its IUPAC name is 4-[6-(4-bromophenyl)-3-(furan-2-yl)-1,2,4-triazin-5-yl]morpholine.
| Compound Name | 4-[6-(4-bromophenyl)-3-(furan-2-yl)-1,2,4-triazin-5-yl]morpholine |
|---|---|
| PubChem CID | 6402428 |
| Molecular Formula | C17H15BrN4O2 |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 4-[6-(4-bromophenyl)-3-(furan-2-yl)-1,2,4-triazin-5-yl]morpholine |
| SMILES | Brc1ccc(-c2nnc(-c3ccco3)nc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H15BrN4O2/c18-13-5-3-12(4-6-13)15-17(22-7-10-23-11-8-22)19-16(21-20-15)14-2-1-9-24-14/h1-6,9H,7-8,10-11H2 |
| InChIKey | DKTYICNNGILWQT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |