C20H16F3N3OS — CID 6402505
2-(6-phenylpyridazin-3-yl)sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 6402505) has the molecular formula C20H16F3N3OS and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-(6-phenylpyridazin-3-yl)sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(6-phenylpyridazin-3-yl)sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6402505 |
| Molecular Formula | C20H16F3N3OS |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-(6-phenylpyridazin-3-yl)sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(CSc1ccc(-c2ccccc2)nn1)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F3N3OS/c21-20(22,23)16-8-4-5-14(11-16)12-24-18(27)13-28-19-10-9-17(25-26-19)15-6-2-1-3-7-15/h1-11H,12-13H2,(H,24,27) |
| InChIKey | CIPSIZNBWVLTTR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |