C26H23N3O3S — CID 6402590
morpholin-4-yl-[5-[[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylmethyl]furan-2-yl]methanone (PubChem CID 6402590) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is morpholin-4-yl-[5-[[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylmethyl]furan-2-yl]methanone.
| Compound Name | morpholin-4-yl-[5-[[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylmethyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 6402590 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | morpholin-4-yl-[5-[[6-(4-phenylphenyl)pyridazin-3-yl]sulfanylmethyl]furan-2-yl]methanone |
| SMILES | O=C(c1ccc(CSc2ccc(-c3ccc(-c4ccccc4)cc3)nn2)o1)N1CCOCC1 |
| InChI | InChI=1S/C26H23N3O3S/c30-26(29-14-16-31-17-15-29)24-12-10-22(32-24)18-33-25-13-11-23(27-28-25)21-8-6-20(7-9-21)19-4-2-1-3-5-19/h1-13H,14-18H2 |
| InChIKey | LZSKPHDAQIKPQK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |