C22H20N4O2 — CID 640283
2-(2,5-dimethylphenyl)-5-[(E)-2-[5-(2,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]ethenyl]-1,3,4-oxadiazole (PubChem CID 640283) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-5-[(E)-2-[5-(2,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]ethenyl]-1,3,4-oxadiazole.
| Compound Name | 2-(2,5-dimethylphenyl)-5-[(E)-2-[5-(2,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]ethenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 640283 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-5-[(E)-2-[5-(2,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]ethenyl]-1,3,4-oxadiazole |
| SMILES | Cc1ccc(C)c(-c2nnc(/C=C/c3nnc(-c4cc(C)ccc4C)o3)o2)c1 |
| InChI | InChI=1S/C22H20N4O2/c1-13-5-7-15(3)17(11-13)21-25-23-19(27-21)9-10-20-24-26-22(28-20)18-12-14(2)6-8-16(18)4/h5-12H,1-4H3/b10-9+ |
| InChIKey | WJRZZVHTHYEZPQ-MDZDMXLPSA-N |
| XLogP | 5.19 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |