About 2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole
2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 640340) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole.
Analyze 2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole?
The IUPAC name of 2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole (CID 640340) is 2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole.
What is the SMILES notation for 2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole?
The canonical SMILES for 2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole is Cc1cc(C2=NC(C)(C)CO2)oc1C.
What is the InChIKey of 2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole?
The InChIKey is LURINAKVTAHSQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-7-5-9(14-8(7)2)10-12-11(3,4)6-13-10/h5H,6H2,1-4H3.
What are the key properties of 2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole?
2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole has a molecular weight of 193.25 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole is sourced from PubChem (CID 640340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).