About 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole
2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 640342) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole |
| PubChem CID | 640342 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | Cc1oc(C2=NC(C)(C)CO2)cc1C(C)(C)C |
| InChI | InChI=1S/C14H21NO2/c1-9-10(13(2,3)4)7-11(17-9)12-15-14(5,6)8-16-12/h7H,8H2,1-6H3 |
| InChIKey | FHUCMXDGYUOVCZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole?
The IUPAC name of 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole (CID 640342) is 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole.
What is the SMILES notation for 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole?
The canonical SMILES for 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole is Cc1oc(C2=NC(C)(C)CO2)cc1C(C)(C)C.
What is the InChIKey of 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole?
The InChIKey is FHUCMXDGYUOVCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-9-10(13(2,3)4)7-11(17-9)12-15-14(5,6)8-16-12/h7H,8H2,1-6H3.
What are the key properties of 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole?
2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole has a molecular weight of 235.33 g/mol, XLogP of 3.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butyl-5-methylfuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole is sourced from PubChem (CID 640342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).