About 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone
1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone (PubChem CID 640343) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone |
| PubChem CID | 640343 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone |
| SMILES | C=CCc1c(C2=NC(C)(C)CO2)oc(C)c1C(C)=O |
| InChI | InChI=1S/C15H19NO3/c1-6-7-11-12(9(2)17)10(3)19-13(11)14-16-15(4,5)8-18-14/h6H,1,7-8H2,2-5H3 |
| InChIKey | SYEHMHRDVNDJKK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone?
The IUPAC name of 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone (CID 640343) is 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone.
What is the SMILES notation for 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone?
The canonical SMILES for 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone is C=CCc1c(C2=NC(C)(C)CO2)oc(C)c1C(C)=O.
What is the InChIKey of 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone?
The InChIKey is SYEHMHRDVNDJKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-6-7-11-12(9(2)17)10(3)19-13(11)14-16-15(4,5)8-18-14/h6H,1,7-8H2,2-5H3.
What are the key properties of 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone?
1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone has a molecular weight of 261.32 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methyl-4-prop-2-enylfuran-3-yl]ethanone is sourced from PubChem (CID 640343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).