About difluoromethylbenzene
difluoromethylbenzene (PubChem CID 640452) has the molecular formula C7H6F2
and a molecular weight of 128.12 g/mol. Its IUPAC name is difluoromethylbenzene.
Molecular Properties
| Compound Name | difluoromethylbenzene |
| PubChem CID | 640452 |
| Molecular Formula | C7H6F2 |
| Molecular Weight | 128.12 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | difluoromethylbenzene |
| SMILES | FC(F)c1ccccc1 |
| InChI | InChI=1S/C7H6F2/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | JDZLOJYSBBLXQD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze difluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethylbenzene?
The IUPAC name of difluoromethylbenzene (CID 640452) is difluoromethylbenzene.
What is the SMILES notation for difluoromethylbenzene?
The canonical SMILES for difluoromethylbenzene is FC(F)c1ccccc1.
What is the InChIKey of difluoromethylbenzene?
The InChIKey is JDZLOJYSBBLXQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2/c8-7(9)6-4-2-1-3-5-6/h1-5,7H.
What are the key properties of difluoromethylbenzene?
difluoromethylbenzene has a molecular weight of 128.12 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethylbenzene is sourced from PubChem (CID 640452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).