C20H21N5 — CID 6404647
N-cyclohexyl-6-phenyl-3-pyridin-2-yl-1,2,4-triazin-5-amine (PubChem CID 6404647) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-cyclohexyl-6-phenyl-3-pyridin-2-yl-1,2,4-triazin-5-amine.
| Compound Name | N-cyclohexyl-6-phenyl-3-pyridin-2-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 6404647 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N-cyclohexyl-6-phenyl-3-pyridin-2-yl-1,2,4-triazin-5-amine |
| SMILES | c1ccc(-c2nnc(-c3ccccn3)nc2NC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H21N5/c1-3-9-15(10-4-1)18-20(22-16-11-5-2-6-12-16)23-19(25-24-18)17-13-7-8-14-21-17/h1,3-4,7-10,13-14,16H,2,5-6,11-12H2,(H,22,23,25) |
| InChIKey | LKAMDZUYTXTHDM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |