About 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium
3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium (PubChem CID 6404881) has the molecular formula C12H8N4O2
and a molecular weight of 240.22 g/mol. Its IUPAC name is 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium.
Molecular Properties
| Compound Name | 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium |
| PubChem CID | 6404881 |
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium |
| SMILES | [O-][n+]1cc(-c2ccncc2)nnc1-c1ccco1 |
| InChI | InChI=1S/C12H8N4O2/c17-16-8-10(9-3-5-13-6-4-9)14-15-12(16)11-2-1-7-18-11/h1-8H |
| InChIKey | SBTIYNVJXFLCMB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium?
The IUPAC name of 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium (CID 6404881) is 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium.
What is the SMILES notation for 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium?
The canonical SMILES for 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium is [O-][n+]1cc(-c2ccncc2)nnc1-c1ccco1.
What is the InChIKey of 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium?
The InChIKey is SBTIYNVJXFLCMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O2/c17-16-8-10(9-3-5-13-6-4-9)14-15-12(16)11-2-1-7-18-11/h1-8H.
What are the key properties of 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium?
3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium has a molecular weight of 240.22 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-4-oxido-6-pyridin-4-yl-1,2,4-triazin-4-ium is sourced from PubChem (CID 6404881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).