C19H16N4O — CID 6405233
3-[6-(4-methoxyphenyl)-3-methyl-1,2,4-triazin-5-yl]-1H-indole (PubChem CID 6405233) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-[6-(4-methoxyphenyl)-3-methyl-1,2,4-triazin-5-yl]-1H-indole.
| Compound Name | 3-[6-(4-methoxyphenyl)-3-methyl-1,2,4-triazin-5-yl]-1H-indole |
|---|---|
| PubChem CID | 6405233 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-[6-(4-methoxyphenyl)-3-methyl-1,2,4-triazin-5-yl]-1H-indole |
| SMILES | COc1ccc(-c2nnc(C)nc2-c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C19H16N4O/c1-12-21-19(16-11-20-17-6-4-3-5-15(16)17)18(23-22-12)13-7-9-14(24-2)10-8-13/h3-11,20H,1-2H3 |
| InChIKey | QDHNCVZQVYGRMD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |