C20H14BrN5O2S — CID 6405800
(3S)-5-bromo-3'-prop-2-enylsulfanylspiro[1H-indole-3,6'-7H-[1,2,4]triazino[5,6-d][3,1]benzoxazepine]-2-one (PubChem CID 6405800) has the molecular formula C20H14BrN5O2S and a molecular weight of 468.34 g/mol. Its IUPAC name is (3S)-5-bromo-3'-prop-2-enylsulfanylspiro[1H-indole-3,6'-7H-[1,2,4]triazino[5,6-d][3,1]benzoxazepine]-2-one.
| Compound Name | (3S)-5-bromo-3'-prop-2-enylsulfanylspiro[1H-indole-3,6'-7H-[1,2,4]triazino[5,6-d][3,1]benzoxazepine]-2-one |
|---|---|
| PubChem CID | 6405800 |
| Molecular Formula | C20H14BrN5O2S |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | (3S)-5-bromo-3'-prop-2-enylsulfanylspiro[1H-indole-3,6'-7H-[1,2,4]triazino[5,6-d][3,1]benzoxazepine]-2-one |
| SMILES | C=CCSc1nnc2c(n1)O[C@]1(Nc3ccccc3-2)C(=O)Nc2ccc(Br)cc21 |
| InChI | InChI=1S/C20H14BrN5O2S/c1-2-9-29-19-23-17-16(25-26-19)12-5-3-4-6-14(12)24-20(28-17)13-10-11(21)7-8-15(13)22-18(20)27/h2-8,10,24H,1,9H2,(H,22,27)/t20-/m0/s1 |
| InChIKey | ROXHWDWHSKNCKG-FQEVSTJZSA-N |
| XLogP | 4.19 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|