About 2,2-difluoro-1,3-dihydroindene
2,2-difluoro-1,3-dihydroindene (PubChem CID 640583) has the molecular formula C9H8F2
and a molecular weight of 154.16 g/mol. Its IUPAC name is 2,2-difluoro-1,3-dihydroindene.
Molecular Properties
| Compound Name | 2,2-difluoro-1,3-dihydroindene |
| PubChem CID | 640583 |
| Molecular Formula | C9H8F2 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2,2-difluoro-1,3-dihydroindene |
| SMILES | FC1(F)Cc2ccccc2C1 |
| InChI | InChI=1S/C9H8F2/c10-9(11)5-7-3-1-2-4-8(7)6-9/h1-4H,5-6H2 |
| InChIKey | JORPEJNFWXKNTQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,2-difluoro-1,3-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-1,3-dihydroindene?
The IUPAC name of 2,2-difluoro-1,3-dihydroindene (CID 640583) is 2,2-difluoro-1,3-dihydroindene.
What is the SMILES notation for 2,2-difluoro-1,3-dihydroindene?
The canonical SMILES for 2,2-difluoro-1,3-dihydroindene is FC1(F)Cc2ccccc2C1.
What is the InChIKey of 2,2-difluoro-1,3-dihydroindene?
The InChIKey is JORPEJNFWXKNTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2/c10-9(11)5-7-3-1-2-4-8(7)6-9/h1-4H,5-6H2.
What are the key properties of 2,2-difluoro-1,3-dihydroindene?
2,2-difluoro-1,3-dihydroindene has a molecular weight of 154.16 g/mol, XLogP of 2.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-1,3-dihydroindene is sourced from PubChem (CID 640583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).