About 3-bromo-1-benzofuran
3-bromo-1-benzofuran (PubChem CID 640589) has the molecular formula C8H5BrO
and a molecular weight of 197.03 g/mol. Its IUPAC name is 3-bromo-1-benzofuran.
Molecular Properties
| Compound Name | 3-bromo-1-benzofuran |
| PubChem CID | 640589 |
| Molecular Formula | C8H5BrO |
| Molecular Weight | 197.03 g/mol |
| Exact Mass | 195.95 |
| IUPAC Name | 3-bromo-1-benzofuran |
| SMILES | Brc1coc2ccccc12 |
| InChI | InChI=1S/C8H5BrO/c9-7-5-10-8-4-2-1-3-6(7)8/h1-5H |
| InChIKey | ICJNAOJPUTYWNV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.03 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-benzofuran?
The IUPAC name of 3-bromo-1-benzofuran (CID 640589) is 3-bromo-1-benzofuran.
What is the SMILES notation for 3-bromo-1-benzofuran?
The canonical SMILES for 3-bromo-1-benzofuran is Brc1coc2ccccc12.
What is the InChIKey of 3-bromo-1-benzofuran?
The InChIKey is ICJNAOJPUTYWNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrO/c9-7-5-10-8-4-2-1-3-6(7)8/h1-5H.
What are the key properties of 3-bromo-1-benzofuran?
3-bromo-1-benzofuran has a molecular weight of 197.03 g/mol, XLogP of 3.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-benzofuran is sourced from PubChem (CID 640589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).