C23H23N4O5S- — CID 6406205
2-[2-[(6R)-3-butylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-6-methoxyphenoxy]acetate (PubChem CID 6406205) has the molecular formula C23H23N4O5S- and a molecular weight of 467.53 g/mol. Its IUPAC name is 2-[2-[(6R)-3-butylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-6-methoxyphenoxy]acetate.
| Compound Name | 2-[2-[(6R)-3-butylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 6406205 |
| Molecular Formula | C23H23N4O5S- |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 2-[2-[(6R)-3-butylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-6-methoxyphenoxy]acetate |
| SMILES | CCCCSc1nnc2c(n1)O[C@H](c1cccc(OC)c1OCC(=O)[O-])Nc1ccccc1-2 |
| InChI | InChI=1S/C23H24N4O5S/c1-3-4-12-33-23-25-22-19(26-27-23)14-8-5-6-10-16(14)24-21(32-22)15-9-7-11-17(30-2)20(15)31-13-18(28)29/h5-11,21,24H,3-4,12-13H2,1-2H3,(H,28,29)/p-1/t21-/m1/s1 |
| InChIKey | SLSSMBHVPAHVJO-OAQYLSRUSA-M |
| XLogP | 3.07 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|