About thioxanthene-9-thione
thioxanthene-9-thione (PubChem CID 640634) has the molecular formula C13H8S2
and a molecular weight of 228.34 g/mol. Its IUPAC name is thioxanthene-9-thione.
Molecular Properties
| Compound Name | thioxanthene-9-thione |
| PubChem CID | 640634 |
| Molecular Formula | C13H8S2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | thioxanthene-9-thione |
| SMILES | S=c1c2ccccc2sc2ccccc12 |
| InChI | InChI=1S/C13H8S2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H |
| InChIKey | GFFOQYKXLQSUKD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze thioxanthene-9-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thioxanthene-9-thione?
The IUPAC name of thioxanthene-9-thione (CID 640634) is thioxanthene-9-thione.
What is the SMILES notation for thioxanthene-9-thione?
The canonical SMILES for thioxanthene-9-thione is S=c1c2ccccc2sc2ccccc12.
What is the InChIKey of thioxanthene-9-thione?
The InChIKey is GFFOQYKXLQSUKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8S2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H.
What are the key properties of thioxanthene-9-thione?
thioxanthene-9-thione has a molecular weight of 228.34 g/mol, XLogP of 4.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thioxanthene-9-thione is sourced from PubChem (CID 640634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).