About trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane
trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane (PubChem CID 640654) has the molecular formula C7H10
and a molecular weight of 94.16 g/mol. Its IUPAC name is trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane.
Molecular Properties
| Compound Name | trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane |
| PubChem CID | 640654 |
| Molecular Formula | C7H10 |
| Molecular Weight | 94.16 g/mol |
| Exact Mass | 94.08 |
| IUPAC Name | trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane |
| SMILES | C=C[C@@H]1C[C@H]1C=C |
| InChI | InChI=1S/C7H10/c1-3-6-5-7(6)4-2/h3-4,6-7H,1-2,5H2/t6-,7-/m1/s1 |
| InChIKey | UEYYOGFVPAORCH-RNFRBKRXSA-N |
| XLogP | 1.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.16 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane?
The IUPAC name of trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane (CID 640654) is trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane.
What is the SMILES notation for trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane?
The canonical SMILES for trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane is C=C[C@@H]1C[C@H]1C=C.
What is the InChIKey of trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane?
The InChIKey is UEYYOGFVPAORCH-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H10/c1-3-6-5-7(6)4-2/h3-4,6-7H,1-2,5H2/t6-,7-/m1/s1.
What are the key properties of trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane?
trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane has a molecular weight of 94.16 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-1,2-bis(ethenyl)cyclopropane is sourced from PubChem (CID 640654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).