About (2R)-1,2,3,4-tetrahydronaphthalen-2-ol
(2R)-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 640694) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is (2R)-1,2,3,4-tetrahydronaphthalen-2-ol.
Molecular Properties
| Compound Name | (2R)-1,2,3,4-tetrahydronaphthalen-2-ol |
| PubChem CID | 640694 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (2R)-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | O[C@@H]1CCc2ccccc2C1 |
| InChI | InChI=1S/C10H12O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10-11H,5-7H2/t10-/m1/s1 |
| InChIKey | JWQYZECMEPOAPF-SNVBAGLBSA-N |
| XLogP | 1.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-1,2,3,4-tetrahydronaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,2,3,4-tetrahydronaphthalen-2-ol?
The IUPAC name of (2R)-1,2,3,4-tetrahydronaphthalen-2-ol (CID 640694) is (2R)-1,2,3,4-tetrahydronaphthalen-2-ol.
What is the SMILES notation for (2R)-1,2,3,4-tetrahydronaphthalen-2-ol?
The canonical SMILES for (2R)-1,2,3,4-tetrahydronaphthalen-2-ol is O[C@@H]1CCc2ccccc2C1.
What is the InChIKey of (2R)-1,2,3,4-tetrahydronaphthalen-2-ol?
The InChIKey is JWQYZECMEPOAPF-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H12O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10-11H,5-7H2/t10-/m1/s1.
What are the key properties of (2R)-1,2,3,4-tetrahydronaphthalen-2-ol?
(2R)-1,2,3,4-tetrahydronaphthalen-2-ol has a molecular weight of 148.20 g/mol, XLogP of 1.54, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,2,3,4-tetrahydronaphthalen-2-ol is sourced from PubChem (CID 640694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).