C24H18N4O — CID 6406946
20,20-dimethyl-17-phenyl-11,12,16,17-tetrazapentacyclo[11.7.0.02,10.04,9.014,18]icosa-1,4,6,8,10,12,14(18),15-octaen-3-one (PubChem CID 6406946) has the molecular formula C24H18N4O and a molecular weight of 378.44 g/mol. Its IUPAC name is 20,20-dimethyl-17-phenyl-11,12,16,17-tetrazapentacyclo[11.7.0.02,10.04,9.014,18]icosa-1,4,6,8,10,12,14(18),15-octaen-3-one.
| Compound Name | 20,20-dimethyl-17-phenyl-11,12,16,17-tetrazapentacyclo[11.7.0.02,10.04,9.014,18]icosa-1,4,6,8,10,12,14(18),15-octaen-3-one |
|---|---|
| PubChem CID | 6406946 |
| Molecular Formula | C24H18N4O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 20,20-dimethyl-17-phenyl-11,12,16,17-tetrazapentacyclo[11.7.0.02,10.04,9.014,18]icosa-1,4,6,8,10,12,14(18),15-octaen-3-one |
| SMILES | CC1(C)Cc2c(cnn2-c2ccccc2)-c2nnc3c(c21)C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C24H18N4O/c1-24(2)12-18-17(13-25-28(18)14-8-4-3-5-9-14)22-20(24)19-21(26-27-22)15-10-6-7-11-16(15)23(19)29/h3-11,13H,12H2,1-2H3 |
| InChIKey | NGMGOQWMWFUXTF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|